C16H19FN2O — CID 43783758
3-[1-(2-bicyclo[2.2.1]hept-5-enyl)ethylamino]-4-fluorobenzamide (PubChem CID 43783758) has the molecular formula C16H19FN2O and a molecular weight of 274.34 g/mol. Its IUPAC name is 3-[1-(2-bicyclo[2.2.1]hept-5-enyl)ethylamino]-4-fluorobenzamide.
| Compound Name | 3-[1-(2-bicyclo[2.2.1]hept-5-enyl)ethylamino]-4-fluorobenzamide |
|---|---|
| PubChem CID | 43783758 |
| Molecular Formula | C16H19FN2O |
| Molecular Weight | 274.34 g/mol |
| Exact Mass | 274.15 |
| IUPAC Name | 3-[1-(2-bicyclo[2.2.1]hept-5-enyl)ethylamino]-4-fluorobenzamide |
| SMILES | CC(Nc1cc(C(N)=O)ccc1F)C1CC2C=CC1C2 |
| InChI | InChI=1S/C16H19FN2O/c1-9(13-7-10-2-3-11(13)6-10)19-15-8-12(16(18)20)4-5-14(15)17/h2-5,8-11,13,19H,6-7H2,1H3,(H2,18,20) |
| InChIKey | MBFCTKISRZEEIX-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.34 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|