C11H13F3N2O — CID 102868880
3-(1,1-difluoropropan-2-ylamino)-5-fluoro-4-methylbenzamide (PubChem CID 102868880) has the molecular formula C11H13F3N2O and a molecular weight of 246.23 g/mol. Its IUPAC name is 3-(1,1-difluoropropan-2-ylamino)-5-fluoro-4-methylbenzamide.
| Compound Name | 3-(1,1-difluoropropan-2-ylamino)-5-fluoro-4-methylbenzamide |
|---|---|
| PubChem CID | 102868880 |
| Molecular Formula | C11H13F3N2O |
| Molecular Weight | 246.23 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 3-(1,1-difluoropropan-2-ylamino)-5-fluoro-4-methylbenzamide |
| SMILES | Cc1c(F)cc(C(N)=O)cc1NC(C)C(F)F |
| InChI | InChI=1S/C11H13F3N2O/c1-5-8(12)3-7(11(15)17)4-9(5)16-6(2)10(13)14/h3-4,6,10,16H,1-2H3,(H2,15,17) |
| InChIKey | AMISSCFCKZYQOT-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.23 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |