C16H16FIN2O — CID 43789078
3-fluoro-5-[1-(4-iodophenyl)ethylamino]-4-methylbenzamide (PubChem CID 43789078) has the molecular formula C16H16FIN2O and a molecular weight of 398.22 g/mol. Its IUPAC name is 3-fluoro-5-[1-(4-iodophenyl)ethylamino]-4-methylbenzamide.
| Compound Name | 3-fluoro-5-[1-(4-iodophenyl)ethylamino]-4-methylbenzamide |
|---|---|
| PubChem CID | 43789078 |
| Molecular Formula | C16H16FIN2O |
| Molecular Weight | 398.22 g/mol |
| Exact Mass | 398.03 |
| IUPAC Name | 3-fluoro-5-[1-(4-iodophenyl)ethylamino]-4-methylbenzamide |
| SMILES | Cc1c(F)cc(C(N)=O)cc1NC(C)c1ccc(I)cc1 |
| InChI | InChI=1S/C16H16FIN2O/c1-9-14(17)7-12(16(19)21)8-15(9)20-10(2)11-3-5-13(18)6-4-11/h3-8,10,20H,1-2H3,(H2,19,21) |
| InChIKey | FTALPOZQNWVWOK-UHFFFAOYSA-N |
| XLogP | 4.01 |
| TPSA | 55.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.22 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|