C14H11ClFN3O2 — CID 81227752
N-(5-carbamoyl-3-fluoro-2-methylphenyl)-4-chloropyridine-3-carboxamide (PubChem CID 81227752) has the molecular formula C14H11ClFN3O2 and a molecular weight of 307.71 g/mol. Its IUPAC name is N-(5-carbamoyl-3-fluoro-2-methylphenyl)-4-chloropyridine-3-carboxamide.
| Compound Name | N-(5-carbamoyl-3-fluoro-2-methylphenyl)-4-chloropyridine-3-carboxamide |
|---|---|
| PubChem CID | 81227752 |
| Molecular Formula | C14H11ClFN3O2 |
| Molecular Weight | 307.71 g/mol |
| Exact Mass | 307.05 |
| IUPAC Name | N-(5-carbamoyl-3-fluoro-2-methylphenyl)-4-chloropyridine-3-carboxamide |
| SMILES | Cc1c(F)cc(C(N)=O)cc1NC(=O)c1cnccc1Cl |
| InChI | InChI=1S/C14H11ClFN3O2/c1-7-11(16)4-8(13(17)20)5-12(7)19-14(21)9-6-18-3-2-10(9)15/h2-6H,1H3,(H2,17,20)(H,19,21) |
| InChIKey | HCJOAVCAABYRAB-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.71 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |