C13H10BrFN2O3 — CID 47244153
5-bromo-N-(5-carbamoyl-3-fluoro-2-methylphenyl)furan-2-carboxamide (PubChem CID 47244153) has the molecular formula C13H10BrFN2O3 and a molecular weight of 341.14 g/mol. Its IUPAC name is 5-bromo-N-(5-carbamoyl-3-fluoro-2-methylphenyl)furan-2-carboxamide.
| Compound Name | 5-bromo-N-(5-carbamoyl-3-fluoro-2-methylphenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 47244153 |
| Molecular Formula | C13H10BrFN2O3 |
| Molecular Weight | 341.14 g/mol |
| Exact Mass | 339.99 |
| IUPAC Name | 5-bromo-N-(5-carbamoyl-3-fluoro-2-methylphenyl)furan-2-carboxamide |
| SMILES | Cc1c(F)cc(C(N)=O)cc1NC(=O)c1ccc(Br)o1 |
| InChI | InChI=1S/C13H10BrFN2O3/c1-6-8(15)4-7(12(16)18)5-9(6)17-13(19)10-2-3-11(14)20-10/h2-5H,1H3,(H2,16,18)(H,17,19) |
| InChIKey | QTMQCFVPYRJZKD-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.14 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |