C12H7BrFNO4 — CID 60748683
3-[(5-bromofuran-2-carbonyl)amino]-4-fluorobenzoic acid (PubChem CID 60748683) has the molecular formula C12H7BrFNO4 and a molecular weight of 328.09 g/mol. Its IUPAC name is 3-[(5-bromofuran-2-carbonyl)amino]-4-fluorobenzoic acid.
| Compound Name | 3-[(5-bromofuran-2-carbonyl)amino]-4-fluorobenzoic acid |
|---|---|
| PubChem CID | 60748683 |
| Molecular Formula | C12H7BrFNO4 |
| Molecular Weight | 328.09 g/mol |
| Exact Mass | 326.95 |
| IUPAC Name | 3-[(5-bromofuran-2-carbonyl)amino]-4-fluorobenzoic acid |
| SMILES | O=C(O)c1ccc(F)c(NC(=O)c2ccc(Br)o2)c1 |
| InChI | InChI=1S/C12H7BrFNO4/c13-10-4-3-9(19-10)11(16)15-8-5-6(12(17)18)1-2-7(8)14/h1-5H,(H,15,16)(H,17,18) |
| InChIKey | ZRDGPNDJPRTDOJ-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.09 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |