C13H10BrNO4 — CID 107812493
4-bromo-3-[(5-methylfuran-2-carbonyl)amino]benzoic acid (PubChem CID 107812493) has the molecular formula C13H10BrNO4 and a molecular weight of 324.13 g/mol. Its IUPAC name is 4-bromo-3-[(5-methylfuran-2-carbonyl)amino]benzoic acid.
| Compound Name | 4-bromo-3-[(5-methylfuran-2-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 107812493 |
| Molecular Formula | C13H10BrNO4 |
| Molecular Weight | 324.13 g/mol |
| Exact Mass | 322.98 |
| IUPAC Name | 4-bromo-3-[(5-methylfuran-2-carbonyl)amino]benzoic acid |
| SMILES | Cc1ccc(C(=O)Nc2cc(C(=O)O)ccc2Br)o1 |
| InChI | InChI=1S/C13H10BrNO4/c1-7-2-5-11(19-7)12(16)15-10-6-8(13(17)18)3-4-9(10)14/h2-6H,1H3,(H,15,16)(H,17,18) |
| InChIKey | WEZMRRTWCPEPTL-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.13 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |