C13H10INO4 — CID 113352902
3-iodo-5-[(5-methylfuran-2-carbonyl)amino]benzoic acid (PubChem CID 113352902) has the molecular formula C13H10INO4 and a molecular weight of 371.13 g/mol. Its IUPAC name is 3-iodo-5-[(5-methylfuran-2-carbonyl)amino]benzoic acid.
| Compound Name | 3-iodo-5-[(5-methylfuran-2-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 113352902 |
| Molecular Formula | C13H10INO4 |
| Molecular Weight | 371.13 g/mol |
| Exact Mass | 370.97 |
| IUPAC Name | 3-iodo-5-[(5-methylfuran-2-carbonyl)amino]benzoic acid |
| SMILES | Cc1ccc(C(=O)Nc2cc(I)cc(C(=O)O)c2)o1 |
| InChI | InChI=1S/C13H10INO4/c1-7-2-3-11(19-7)12(16)15-10-5-8(13(17)18)4-9(14)6-10/h2-6H,1H3,(H,15,16)(H,17,18) |
| InChIKey | MMZNENIGLJOACM-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.13 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|