C11H10N2O2 — CID 897103
5-methyl-N-pyridin-4-ylfuran-2-carboxamide (PubChem CID 897103) has the molecular formula C11H10N2O2 and a molecular weight of 202.21 g/mol. Its IUPAC name is 5-methyl-N-pyridin-4-ylfuran-2-carboxamide.
| Compound Name | 5-methyl-N-pyridin-4-ylfuran-2-carboxamide |
|---|---|
| PubChem CID | 897103 |
| Molecular Formula | C11H10N2O2 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.07 |
| IUPAC Name | 5-methyl-N-pyridin-4-ylfuran-2-carboxamide |
| SMILES | Cc1ccc(C(=O)Nc2ccncc2)o1 |
| InChI | InChI=1S/C11H10N2O2/c1-8-2-3-10(15-8)11(14)13-9-4-6-12-7-5-9/h2-7H,1H3,(H,12,13,14) |
| InChIKey | XDISZVLSBCXHSU-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |