C13H10FNO4 — CID 103791548
2-fluoro-4-[(5-methylfuran-2-carbonyl)amino]benzoic acid (PubChem CID 103791548) has the molecular formula C13H10FNO4 and a molecular weight of 263.22 g/mol. Its IUPAC name is 2-fluoro-4-[(5-methylfuran-2-carbonyl)amino]benzoic acid.
| Compound Name | 2-fluoro-4-[(5-methylfuran-2-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 103791548 |
| Molecular Formula | C13H10FNO4 |
| Molecular Weight | 263.22 g/mol |
| Exact Mass | 263.06 |
| IUPAC Name | 2-fluoro-4-[(5-methylfuran-2-carbonyl)amino]benzoic acid |
| SMILES | Cc1ccc(C(=O)Nc2ccc(C(=O)O)c(F)c2)o1 |
| InChI | InChI=1S/C13H10FNO4/c1-7-2-5-11(19-7)12(16)15-8-3-4-9(13(17)18)10(14)6-8/h2-6H,1H3,(H,15,16)(H,17,18) |
| InChIKey | KJJSZHSBTARVRP-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.22 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |