C12H9IN2O4 — CID 112750032
3-iodo-5-[(5-methyl-1,2-oxazole-4-carbonyl)amino]benzoic acid (PubChem CID 112750032) has the molecular formula C12H9IN2O4 and a molecular weight of 372.12 g/mol. Its IUPAC name is 3-iodo-5-[(5-methyl-1,2-oxazole-4-carbonyl)amino]benzoic acid.
| Compound Name | 3-iodo-5-[(5-methyl-1,2-oxazole-4-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 112750032 |
| Molecular Formula | C12H9IN2O4 |
| Molecular Weight | 372.12 g/mol |
| Exact Mass | 371.96 |
| IUPAC Name | 3-iodo-5-[(5-methyl-1,2-oxazole-4-carbonyl)amino]benzoic acid |
| SMILES | Cc1oncc1C(=O)Nc1cc(I)cc(C(=O)O)c1 |
| InChI | InChI=1S/C12H9IN2O4/c1-6-10(5-14-19-6)11(16)15-9-3-7(12(17)18)2-8(13)4-9/h2-5H,1H3,(H,15,16)(H,17,18) |
| InChIKey | SQAIFZHCELIREV-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.12 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|