C16H24N2O2 — CID 91575161
ethane;5-methyl-N-phenyl-1,2-oxazole-4-carboxamide;propane (PubChem CID 91575161) has the molecular formula C16H24N2O2 and a molecular weight of 276.38 g/mol. Its IUPAC name is ethane;5-methyl-N-phenyl-1,2-oxazole-4-carboxamide;propane.
| Compound Name | ethane;5-methyl-N-phenyl-1,2-oxazole-4-carboxamide;propane |
|---|---|
| PubChem CID | 91575161 |
| Molecular Formula | C16H24N2O2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.18 |
| IUPAC Name | ethane;5-methyl-N-phenyl-1,2-oxazole-4-carboxamide;propane |
| SMILES | CC.CCC.Cc1oncc1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C11H10N2O2.C3H8.C2H6/c1-8-10(7-12-15-8)11(14)13-9-5-3-2-4-6-9;1-3-2;1-2/h2-7H,1H3,(H,13,14);3H2,1-2H3;1-2H3 |
| InChIKey | WOXLAAFKNZGHQB-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |