C11H9IN2O2 — CID 850525
N-(4-iodophenyl)-5-methyl-1,2-oxazole-4-carboxamide (PubChem CID 850525) has the molecular formula C11H9IN2O2 and a molecular weight of 328.11 g/mol. Its IUPAC name is N-(4-iodophenyl)-5-methyl-1,2-oxazole-4-carboxamide.
| Compound Name | N-(4-iodophenyl)-5-methyl-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 850525 |
| Molecular Formula | C11H9IN2O2 |
| Molecular Weight | 328.11 g/mol |
| Exact Mass | 327.97 |
| IUPAC Name | N-(4-iodophenyl)-5-methyl-1,2-oxazole-4-carboxamide |
| SMILES | Cc1oncc1C(=O)Nc1ccc(I)cc1 |
| InChI | InChI=1S/C11H9IN2O2/c1-7-10(6-13-16-7)11(15)14-9-4-2-8(12)3-5-9/h2-6H,1H3,(H,14,15) |
| InChIKey | LTOIKBCWFOMQRB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.11 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|