C12H6BrF3INO2 — CID 3473060
5-bromo-N-[4-iodo-2-(trifluoromethyl)phenyl]furan-2-carboxamide (PubChem CID 3473060) has the molecular formula C12H6BrF3INO2 and a molecular weight of 459.99 g/mol. Its IUPAC name is 5-bromo-N-[4-iodo-2-(trifluoromethyl)phenyl]furan-2-carboxamide.
| Compound Name | 5-bromo-N-[4-iodo-2-(trifluoromethyl)phenyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 3473060 |
| Molecular Formula | C12H6BrF3INO2 |
| Molecular Weight | 459.99 g/mol |
| Exact Mass | 458.86 |
| IUPAC Name | 5-bromo-N-[4-iodo-2-(trifluoromethyl)phenyl]furan-2-carboxamide |
| SMILES | O=C(Nc1ccc(I)cc1C(F)(F)F)c1ccc(Br)o1 |
| InChI | InChI=1S/C12H6BrF3INO2/c13-10-4-3-9(20-10)11(19)18-8-2-1-6(17)5-7(8)12(14,15)16/h1-5H,(H,18,19) |
| InChIKey | XHDMYIVCEHJWKO-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 42.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.99 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|