C16H11F3INO3 — CID 2977921
N-[4-iodo-2-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide (PubChem CID 2977921) has the molecular formula C16H11F3INO3 and a molecular weight of 449.17 g/mol. Its IUPAC name is N-[4-iodo-2-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide.
| Compound Name | N-[4-iodo-2-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
|---|---|
| PubChem CID | 2977921 |
| Molecular Formula | C16H11F3INO3 |
| Molecular Weight | 449.17 g/mol |
| Exact Mass | 448.97 |
| IUPAC Name | N-[4-iodo-2-(trifluoromethyl)phenyl]-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
| SMILES | O=C(Nc1ccc(I)cc1C(F)(F)F)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C16H11F3INO3/c17-16(18,19)11-8-10(20)2-3-12(11)21-15(22)9-1-4-13-14(7-9)24-6-5-23-13/h1-4,7-8H,5-6H2,(H,21,22) |
| InChIKey | CKOZZJGWWMZJKK-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.17 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|