2-(2,3-dihydro-1,4-benzodioxine-6-carbonylamino)benzoic acid

C16H13NO5 — CID 6490722

IUPAC2-(2,3-dihydro-1,4-benzodioxine-6-carbonylamino)benzoic acid
SMILESO=C(Nc1ccccc1C(=O)O)c1ccc2c(c1)OCCO2
InChIInChI=1S/C16H13NO5/c18-15(17-12-4-2-1-3-11(12)16(19)20)10-5-6-13-14(9-10)22-8-7-21-13/h1-6,9H,7-8H2,(H,17,18)(H,19,20)
InChIKeyHXGXPXKVLABNON-UHFFFAOYSA-N
MW299.28 g/mol
LogP2.41
Rot. Bonds3

About 2-(2,3-dihydro-1,4-benzodioxine-6-carbonylamino)benzoic acid

2-(2,3-dihydro-1,4-benzodioxine-6-carbonylamino)benzoic acid (PubChem CID 6490722) has the molecular formula C16H13NO5 and a molecular weight of 299.28 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxine-6-carbonylamino)benzoic acid.

Molecular Properties

Compound Name2-(2,3-dihydro-1,4-benzodioxine-6-carbonylamino)benzoic acid
PubChem CID6490722
Molecular FormulaC16H13NO5
Molecular Weight299.28 g/mol
Exact Mass299.08
IUPAC Name2-(2,3-dihydro-1,4-benzodioxine-6-carbonylamino)benzoic acid
SMILESO=C(Nc1ccccc1C(=O)O)c1ccc2c(c1)OCCO2
InChIInChI=1S/C16H13NO5/c18-15(17-12-4-2-1-3-11(12)16(19)20)10-5-6-13-14(9-10)22-8-7-21-13/h1-6,9H,7-8H2,(H,17,18)(H,19,20)
InChIKeyHXGXPXKVLABNON-UHFFFAOYSA-N
XLogP2.41
TPSA84.86 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms22
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500299.28
LogP ≤ 52.41
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze 2-(2,3-dihydro-1,4-benzodioxine-6-carbonylamino)benzoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2,3-dihydro-1,4-benzodioxine-6-carbonylamino)benzoic acid?
The IUPAC name of 2-(2,3-dihydro-1,4-benzodioxine-6-carbonylamino)benzoic acid (CID 6490722) is 2-(2,3-dihydro-1,4-benzodioxine-6-carbonylamino)benzoic acid.
What is the SMILES notation for 2-(2,3-dihydro-1,4-benzodioxine-6-carbonylamino)benzoic acid?
The canonical SMILES for 2-(2,3-dihydro-1,4-benzodioxine-6-carbonylamino)benzoic acid is O=C(Nc1ccccc1C(=O)O)c1ccc2c(c1)OCCO2.
What is the InChIKey of 2-(2,3-dihydro-1,4-benzodioxine-6-carbonylamino)benzoic acid?
The InChIKey is HXGXPXKVLABNON-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H13NO5/c18-15(17-12-4-2-1-3-11(12)16(19)20)10-5-6-13-14(9-10)22-8-7-21-13/h1-6,9H,7-8H2,(H,17,18)(H,19,20).
What are the key properties of 2-(2,3-dihydro-1,4-benzodioxine-6-carbonylamino)benzoic acid?
2-(2,3-dihydro-1,4-benzodioxine-6-carbonylamino)benzoic acid has a molecular weight of 299.28 g/mol, XLogP of 2.41, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,3-dihydro-1,4-benzodioxine-6-carbonylamino)benzoic acid is sourced from PubChem (CID 6490722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).