C16H13NO5 — CID 6490722
2-(2,3-dihydro-1,4-benzodioxine-6-carbonylamino)benzoic acid (PubChem CID 6490722) has the molecular formula C16H13NO5 and a molecular weight of 299.28 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxine-6-carbonylamino)benzoic acid.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxine-6-carbonylamino)benzoic acid |
|---|---|
| PubChem CID | 6490722 |
| Molecular Formula | C16H13NO5 |
| Molecular Weight | 299.28 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxine-6-carbonylamino)benzoic acid |
| SMILES | O=C(Nc1ccccc1C(=O)O)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C16H13NO5/c18-15(17-12-4-2-1-3-11(12)16(19)20)10-5-6-13-14(9-10)22-8-7-21-13/h1-6,9H,7-8H2,(H,17,18)(H,19,20) |
| InChIKey | HXGXPXKVLABNON-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.28 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |