C22H16ClNO4 — CID 1326741
N-(2-benzoyl-4-chlorophenyl)-2,3-dihydro-1,4-benzodioxine-6-carboxamide (PubChem CID 1326741) has the molecular formula C22H16ClNO4 and a molecular weight of 393.83 g/mol. Its IUPAC name is N-(2-benzoyl-4-chlorophenyl)-2,3-dihydro-1,4-benzodioxine-6-carboxamide.
| Compound Name | N-(2-benzoyl-4-chlorophenyl)-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
|---|---|
| PubChem CID | 1326741 |
| Molecular Formula | C22H16ClNO4 |
| Molecular Weight | 393.83 g/mol |
| Exact Mass | 393.08 |
| IUPAC Name | N-(2-benzoyl-4-chlorophenyl)-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1C(=O)c1ccccc1)c1ccc2c(c1)OCCO2 |
| InChI | InChI=1S/C22H16ClNO4/c23-16-7-8-18(17(13-16)21(25)14-4-2-1-3-5-14)24-22(26)15-6-9-19-20(12-15)28-11-10-27-19/h1-9,12-13H,10-11H2,(H,24,26) |
| InChIKey | PURLFPZUROPVKC-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.83 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |