C22H17ClN2O4 — CID 7333467
1-(7-benzoyl-2,3-dihydro-1,4-benzodioxin-6-yl)-3-(4-chlorophenyl)urea (PubChem CID 7333467) has the molecular formula C22H17ClN2O4 and a molecular weight of 408.84 g/mol. Its IUPAC name is 1-(7-benzoyl-2,3-dihydro-1,4-benzodioxin-6-yl)-3-(4-chlorophenyl)urea.
| Compound Name | 1-(7-benzoyl-2,3-dihydro-1,4-benzodioxin-6-yl)-3-(4-chlorophenyl)urea |
|---|---|
| PubChem CID | 7333467 |
| Molecular Formula | C22H17ClN2O4 |
| Molecular Weight | 408.84 g/mol |
| Exact Mass | 408.09 |
| IUPAC Name | 1-(7-benzoyl-2,3-dihydro-1,4-benzodioxin-6-yl)-3-(4-chlorophenyl)urea |
| SMILES | O=C(Nc1ccc(Cl)cc1)Nc1cc2c(cc1C(=O)c1ccccc1)OCCO2 |
| InChI | InChI=1S/C22H17ClN2O4/c23-15-6-8-16(9-7-15)24-22(27)25-18-13-20-19(28-10-11-29-20)12-17(18)21(26)14-4-2-1-3-5-14/h1-9,12-13H,10-11H2,(H2,24,25,27) |
| InChIKey | CPRFFHNLNALTKJ-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.84 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |