C22H15ClN2O6 — CID 4242967
N-[7-(4-chlorobenzoyl)-2,3-dihydro-1,4-benzodioxin-6-yl]-4-nitrobenzamide (PubChem CID 4242967) has the molecular formula C22H15ClN2O6 and a molecular weight of 438.82 g/mol. Its IUPAC name is N-[7-(4-chlorobenzoyl)-2,3-dihydro-1,4-benzodioxin-6-yl]-4-nitrobenzamide.
| Compound Name | N-[7-(4-chlorobenzoyl)-2,3-dihydro-1,4-benzodioxin-6-yl]-4-nitrobenzamide |
|---|---|
| PubChem CID | 4242967 |
| Molecular Formula | C22H15ClN2O6 |
| Molecular Weight | 438.82 g/mol |
| Exact Mass | 438.06 |
| IUPAC Name | N-[7-(4-chlorobenzoyl)-2,3-dihydro-1,4-benzodioxin-6-yl]-4-nitrobenzamide |
| SMILES | O=C(Nc1cc2c(cc1C(=O)c1ccc(Cl)cc1)OCCO2)c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C22H15ClN2O6/c23-15-5-1-13(2-6-15)21(26)17-11-19-20(31-10-9-30-19)12-18(17)24-22(27)14-3-7-16(8-4-14)25(28)29/h1-8,11-12H,9-10H2,(H,24,27) |
| InChIKey | OMMFVWVGNVAFLJ-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.82 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|