C22H16N2O6 — CID 5297900
N-(7-benzoyl-2,3-dihydro-1,4-benzodioxin-6-yl)-3-nitrobenzamide (PubChem CID 5297900) has the molecular formula C22H16N2O6 and a molecular weight of 404.38 g/mol. Its IUPAC name is N-(7-benzoyl-2,3-dihydro-1,4-benzodioxin-6-yl)-3-nitrobenzamide.
| Compound Name | N-(7-benzoyl-2,3-dihydro-1,4-benzodioxin-6-yl)-3-nitrobenzamide |
|---|---|
| PubChem CID | 5297900 |
| Molecular Formula | C22H16N2O6 |
| Molecular Weight | 404.38 g/mol |
| Exact Mass | 404.10 |
| IUPAC Name | N-(7-benzoyl-2,3-dihydro-1,4-benzodioxin-6-yl)-3-nitrobenzamide |
| SMILES | O=C(Nc1cc2c(cc1C(=O)c1ccccc1)OCCO2)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C22H16N2O6/c25-21(14-5-2-1-3-6-14)17-12-19-20(30-10-9-29-19)13-18(17)23-22(26)15-7-4-8-16(11-15)24(27)28/h1-8,11-13H,9-10H2,(H,23,26) |
| InChIKey | SBRKSEIOFXGTAF-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 107.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.38 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|