C25H19Cl2NO4 — CID 2969858
N-(7-benzoyl-2,3-dihydro-1,4-benzodioxin-6-yl)-4-(2,2-dichlorocyclopropyl)benzamide (PubChem CID 2969858) has the molecular formula C25H19Cl2NO4 and a molecular weight of 468.34 g/mol. Its IUPAC name is N-(7-benzoyl-2,3-dihydro-1,4-benzodioxin-6-yl)-4-(2,2-dichlorocyclopropyl)benzamide.
| Compound Name | N-(7-benzoyl-2,3-dihydro-1,4-benzodioxin-6-yl)-4-(2,2-dichlorocyclopropyl)benzamide |
|---|---|
| PubChem CID | 2969858 |
| Molecular Formula | C25H19Cl2NO4 |
| Molecular Weight | 468.34 g/mol |
| Exact Mass | 467.07 |
| IUPAC Name | N-(7-benzoyl-2,3-dihydro-1,4-benzodioxin-6-yl)-4-(2,2-dichlorocyclopropyl)benzamide |
| SMILES | O=C(Nc1cc2c(cc1C(=O)c1ccccc1)OCCO2)c1ccc(C2CC2(Cl)Cl)cc1 |
| InChI | InChI=1S/C25H19Cl2NO4/c26-25(27)14-19(25)15-6-8-17(9-7-15)24(30)28-20-13-22-21(31-10-11-32-22)12-18(20)23(29)16-4-2-1-3-5-16/h1-9,12-13,19H,10-11,14H2,(H,28,30) |
| InChIKey | KSBYDXZIKBSNIU-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.34 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|