C18H12N4O3 — CID 169339144
2-[(7-benzoyl-2,3-dihydro-1,4-benzodioxin-6-yl)hydrazinylidene]propanedinitrile (PubChem CID 169339144) has the molecular formula C18H12N4O3 and a molecular weight of 332.32 g/mol. Its IUPAC name is 2-[(7-benzoyl-2,3-dihydro-1,4-benzodioxin-6-yl)hydrazinylidene]propanedinitrile.
| Compound Name | 2-[(7-benzoyl-2,3-dihydro-1,4-benzodioxin-6-yl)hydrazinylidene]propanedinitrile |
|---|---|
| PubChem CID | 169339144 |
| Molecular Formula | C18H12N4O3 |
| Molecular Weight | 332.32 g/mol |
| Exact Mass | 332.09 |
| IUPAC Name | 2-[(7-benzoyl-2,3-dihydro-1,4-benzodioxin-6-yl)hydrazinylidene]propanedinitrile |
| SMILES | N#CC(C#N)=NNc1cc2c(cc1C(=O)c1ccccc1)OCCO2 |
| InChI | InChI=1S/C18H12N4O3/c19-10-13(11-20)21-22-15-9-17-16(24-6-7-25-17)8-14(15)18(23)12-4-2-1-3-5-12/h1-5,8-9,22H,6-7H2 |
| InChIKey | QOFHAAHUERKETR-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 107.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.32 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anthranil_one_A(38)', 'substructure': 'N/A'}, {'alert_name': 'cyano_imine_B(17)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|