C15H13IN2O3 — CID 122585498
N-(3-amino-4-iodophenyl)-2,3-dihydro-1,4-benzodioxine-6-carboxamide (PubChem CID 122585498) has the molecular formula C15H13IN2O3 and a molecular weight of 396.18 g/mol. Its IUPAC name is N-(3-amino-4-iodophenyl)-2,3-dihydro-1,4-benzodioxine-6-carboxamide.
| Compound Name | N-(3-amino-4-iodophenyl)-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
|---|---|
| PubChem CID | 122585498 |
| Molecular Formula | C15H13IN2O3 |
| Molecular Weight | 396.18 g/mol |
| Exact Mass | 396.00 |
| IUPAC Name | N-(3-amino-4-iodophenyl)-2,3-dihydro-1,4-benzodioxine-6-carboxamide |
| SMILES | Nc1cc(NC(=O)c2ccc3c(c2)OCCO3)ccc1I |
| InChI | InChI=1S/C15H13IN2O3/c16-11-3-2-10(8-12(11)17)18-15(19)9-1-4-13-14(7-9)21-6-5-20-13/h1-4,7-8H,5-6,17H2,(H,18,19) |
| InChIKey | IKPOARXXJDNHTG-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.18 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|