C15H15N3O2 — CID 174919262
2-(4-amino-2-methylphenyl)benzene-1,4-dicarboxamide (PubChem CID 174919262) has the molecular formula C15H15N3O2 and a molecular weight of 269.30 g/mol. Its IUPAC name is 2-(4-amino-2-methylphenyl)benzene-1,4-dicarboxamide.
| Compound Name | 2-(4-amino-2-methylphenyl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 174919262 |
| Molecular Formula | C15H15N3O2 |
| Molecular Weight | 269.30 g/mol |
| Exact Mass | 269.12 |
| IUPAC Name | 2-(4-amino-2-methylphenyl)benzene-1,4-dicarboxamide |
| SMILES | Cc1cc(N)ccc1-c1cc(C(N)=O)ccc1C(N)=O |
| InChI | InChI=1S/C15H15N3O2/c1-8-6-10(16)3-5-11(8)13-7-9(14(17)19)2-4-12(13)15(18)20/h2-7H,16H2,1H3,(H2,17,19)(H2,18,20) |
| InChIKey | AUUDOAKLDZJAES-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 112.20 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.30 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|