About carbamic acid;3-methyl-4-phenylaniline
carbamic acid;3-methyl-4-phenylaniline (PubChem CID 175552466) has the molecular formula C14H16N2O2
and a molecular weight of 244.29 g/mol. Its IUPAC name is carbamic acid;3-methyl-4-phenylaniline.
Molecular Properties
| Compound Name | carbamic acid;3-methyl-4-phenylaniline |
| PubChem CID | 175552466 |
| Molecular Formula | C14H16N2O2 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.12 |
| IUPAC Name | carbamic acid;3-methyl-4-phenylaniline |
| SMILES | Cc1cc(N)ccc1-c1ccccc1.NC(=O)O |
| InChI | InChI=1S/C13H13N.CH3NO2/c1-10-9-12(14)7-8-13(10)11-5-3-2-4-6-11;2-1(3)4/h2-9H,14H2,1H3;2H2,(H,3,4) |
| InChIKey | SDCBIYZXRFNSNS-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 89.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze carbamic acid;3-methyl-4-phenylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbamic acid;3-methyl-4-phenylaniline?
The IUPAC name of carbamic acid;3-methyl-4-phenylaniline (CID 175552466) is carbamic acid;3-methyl-4-phenylaniline.
What is the SMILES notation for carbamic acid;3-methyl-4-phenylaniline?
The canonical SMILES for carbamic acid;3-methyl-4-phenylaniline is Cc1cc(N)ccc1-c1ccccc1.NC(=O)O.
What is the InChIKey of carbamic acid;3-methyl-4-phenylaniline?
The InChIKey is SDCBIYZXRFNSNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N.CH3NO2/c1-10-9-12(14)7-8-13(10)11-5-3-2-4-6-11;2-1(3)4/h2-9H,14H2,1H3;2H2,(H,3,4).
What are the key properties of carbamic acid;3-methyl-4-phenylaniline?
carbamic acid;3-methyl-4-phenylaniline has a molecular weight of 244.29 g/mol, XLogP of 2.87, 1 rotatable bonds, 3 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for carbamic acid;3-methyl-4-phenylaniline is sourced from PubChem (CID 175552466), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).