C7H7NOS2 — CID 22988615
3,5-bis(sulfanyl)benzamide (PubChem CID 22988615) has the molecular formula C7H7NOS2 and a molecular weight of 185.27 g/mol. Its IUPAC name is 3,5-bis(sulfanyl)benzamide.
| Compound Name | 3,5-bis(sulfanyl)benzamide |
|---|---|
| PubChem CID | 22988615 |
| Molecular Formula | C7H7NOS2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.00 |
| IUPAC Name | 3,5-bis(sulfanyl)benzamide |
| SMILES | NC(=O)c1cc(S)cc(S)c1 |
| InChI | InChI=1S/C7H7NOS2/c8-7(9)4-1-5(10)3-6(11)2-4/h1-3,10-11H,(H2,8,9) |
| InChIKey | KLRCJFXMOTZBTI-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|