C9H10OS2 — CID 118852624
1-[3,5-bis(sulfanyl)phenyl]propan-1-one (PubChem CID 118852624) has the molecular formula C9H10OS2 and a molecular weight of 198.31 g/mol. Its IUPAC name is 1-[3,5-bis(sulfanyl)phenyl]propan-1-one.
| Compound Name | 1-[3,5-bis(sulfanyl)phenyl]propan-1-one |
|---|---|
| PubChem CID | 118852624 |
| Molecular Formula | C9H10OS2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.02 |
| IUPAC Name | 1-[3,5-bis(sulfanyl)phenyl]propan-1-one |
| SMILES | CCC(=O)c1cc(S)cc(S)c1 |
| InChI | InChI=1S/C9H10OS2/c1-2-9(10)6-3-7(11)5-8(12)4-6/h3-5,11-12H,2H2,1H3 |
| InChIKey | SIXHWDCJDLTKPF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|