C11H16N2O — CID 59059856
1-[3,5-bis(methylamino)phenyl]propan-1-one (PubChem CID 59059856) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 1-[3,5-bis(methylamino)phenyl]propan-1-one.
| Compound Name | 1-[3,5-bis(methylamino)phenyl]propan-1-one |
|---|---|
| PubChem CID | 59059856 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 1-[3,5-bis(methylamino)phenyl]propan-1-one |
| SMILES | CCC(=O)c1cc(NC)cc(NC)c1 |
| InChI | InChI=1S/C11H16N2O/c1-4-11(14)8-5-9(12-2)7-10(6-8)13-3/h5-7,12-13H,4H2,1-3H3 |
| InChIKey | JFKDWMUBTRBWRH-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |