C9H11FO2S — CID 144923776
(4,5-dimethoxy-2-methylphenyl) thiohypofluorite (PubChem CID 144923776) has the molecular formula C9H11FO2S and a molecular weight of 202.25 g/mol. Its IUPAC name is (4,5-dimethoxy-2-methylphenyl) thiohypofluorite.
| Compound Name | (4,5-dimethoxy-2-methylphenyl) thiohypofluorite |
|---|---|
| PubChem CID | 144923776 |
| Molecular Formula | C9H11FO2S |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.05 |
| IUPAC Name | (4,5-dimethoxy-2-methylphenyl) thiohypofluorite |
| SMILES | COc1cc(C)c(SF)cc1OC |
| InChI | InChI=1S/C9H11FO2S/c1-6-4-7(11-2)8(12-3)5-9(6)13-10/h4-5H,1-3H3 |
| InChIKey | TYGXSCKVVLZVPS-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |