C10H14O2S — CID 117033384
(2-methoxy-4,5-dimethylphenyl)sulfanylmethanol (PubChem CID 117033384) has the molecular formula C10H14O2S and a molecular weight of 198.29 g/mol. Its IUPAC name is (2-methoxy-4,5-dimethylphenyl)sulfanylmethanol.
| Compound Name | (2-methoxy-4,5-dimethylphenyl)sulfanylmethanol |
|---|---|
| PubChem CID | 117033384 |
| Molecular Formula | C10H14O2S |
| Molecular Weight | 198.29 g/mol |
| Exact Mass | 198.07 |
| IUPAC Name | (2-methoxy-4,5-dimethylphenyl)sulfanylmethanol |
| SMILES | COc1cc(C)c(C)cc1SCO |
| InChI | InChI=1S/C10H14O2S/c1-7-4-9(12-3)10(13-6-11)5-8(7)2/h4-5,11H,6H2,1-3H3 |
| InChIKey | DMNLTONBPDJOFI-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.29 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|