C11H15ClOS — CID 117033356
1-(2-chloroethylsulfanyl)-2-methoxy-4,5-dimethylbenzene (PubChem CID 117033356) has the molecular formula C11H15ClOS and a molecular weight of 230.76 g/mol. Its IUPAC name is 1-(2-chloroethylsulfanyl)-2-methoxy-4,5-dimethylbenzene.
| Compound Name | 1-(2-chloroethylsulfanyl)-2-methoxy-4,5-dimethylbenzene |
|---|---|
| PubChem CID | 117033356 |
| Molecular Formula | C11H15ClOS |
| Molecular Weight | 230.76 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | 1-(2-chloroethylsulfanyl)-2-methoxy-4,5-dimethylbenzene |
| SMILES | COc1cc(C)c(C)cc1SCCCl |
| InChI | InChI=1S/C11H15ClOS/c1-8-6-10(13-3)11(7-9(8)2)14-5-4-12/h6-7H,4-5H2,1-3H3 |
| InChIKey | CLUIOLRSOSGTKA-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.76 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|