C12H18O3S — CID 86790511
1-(ethoxymethylsulfanyl)-4,5-dimethoxy-2-methylbenzene (PubChem CID 86790511) has the molecular formula C12H18O3S and a molecular weight of 242.34 g/mol. Its IUPAC name is 1-(ethoxymethylsulfanyl)-4,5-dimethoxy-2-methylbenzene.
| Compound Name | 1-(ethoxymethylsulfanyl)-4,5-dimethoxy-2-methylbenzene |
|---|---|
| PubChem CID | 86790511 |
| Molecular Formula | C12H18O3S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | 1-(ethoxymethylsulfanyl)-4,5-dimethoxy-2-methylbenzene |
| SMILES | CCOCSc1cc(OC)c(OC)cc1C |
| InChI | InChI=1S/C12H18O3S/c1-5-15-8-16-12-7-11(14-4)10(13-3)6-9(12)2/h6-7H,5,8H2,1-4H3 |
| InChIKey | IGBDMEFMYIICRH-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|