C11H13FO3 — CID 105465798
2-(4,5-dimethoxy-2-methylphenyl)-2-fluoroacetaldehyde (PubChem CID 105465798) has the molecular formula C11H13FO3 and a molecular weight of 212.22 g/mol. Its IUPAC name is 2-(4,5-dimethoxy-2-methylphenyl)-2-fluoroacetaldehyde.
| Compound Name | 2-(4,5-dimethoxy-2-methylphenyl)-2-fluoroacetaldehyde |
|---|---|
| PubChem CID | 105465798 |
| Molecular Formula | C11H13FO3 |
| Molecular Weight | 212.22 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 2-(4,5-dimethoxy-2-methylphenyl)-2-fluoroacetaldehyde |
| SMILES | COc1cc(C)c(C(F)C=O)cc1OC |
| InChI | InChI=1S/C11H13FO3/c1-7-4-10(14-2)11(15-3)5-8(7)9(12)6-13/h4-6,9H,1-3H3 |
| InChIKey | CIVZUSRNKSFQBZ-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.22 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|