C8H11NaO2S — CID 175319936
sodium;3,4-dimethoxybenzenethiol;hydride (PubChem CID 175319936) has the molecular formula C8H11NaO2S and a molecular weight of 194.23 g/mol. Its IUPAC name is sodium;3,4-dimethoxybenzenethiol;hydride.
| Compound Name | sodium;3,4-dimethoxybenzenethiol;hydride |
|---|---|
| PubChem CID | 175319936 |
| Molecular Formula | C8H11NaO2S |
| Molecular Weight | 194.23 g/mol |
| Exact Mass | 194.04 |
| IUPAC Name | sodium;3,4-dimethoxybenzenethiol;hydride |
| SMILES | COc1ccc(S)cc1OC.[H-].[Na+] |
| InChI | InChI=1S/C8H10O2S.Na.H/c1-9-7-4-3-6(11)5-8(7)10-2;;/h3-5,11H,1-2H3;;/q;+1;-1 |
| InChIKey | CTOWBXSCODHWHN-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.23 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|