C11H16O2S — CID 130436084
4,5-dimethoxy-2-propan-2-ylbenzenethiol (PubChem CID 130436084) has the molecular formula C11H16O2S and a molecular weight of 212.31 g/mol. Its IUPAC name is 4,5-dimethoxy-2-propan-2-ylbenzenethiol.
| Compound Name | 4,5-dimethoxy-2-propan-2-ylbenzenethiol |
|---|---|
| PubChem CID | 130436084 |
| Molecular Formula | C11H16O2S |
| Molecular Weight | 212.31 g/mol |
| Exact Mass | 212.09 |
| IUPAC Name | 4,5-dimethoxy-2-propan-2-ylbenzenethiol |
| SMILES | COc1cc(S)c(C(C)C)cc1OC |
| InChI | InChI=1S/C11H16O2S/c1-7(2)8-5-9(12-3)10(13-4)6-11(8)14/h5-7,14H,1-4H3 |
| InChIKey | ZVUXQGSTVMMQQE-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.31 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|