About 1-(disulfanyl)-2,5-dimethoxy-4-propan-2-ylbenzene
1-(disulfanyl)-2,5-dimethoxy-4-propan-2-ylbenzene (PubChem CID 134182107) has the molecular formula C11H16O2S2
and a molecular weight of 244.38 g/mol. Its IUPAC name is 1-(disulfanyl)-2,5-dimethoxy-4-propan-2-ylbenzene.
Molecular Properties
| Compound Name | 1-(disulfanyl)-2,5-dimethoxy-4-propan-2-ylbenzene |
| PubChem CID | 134182107 |
| Molecular Formula | C11H16O2S2 |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.06 |
| IUPAC Name | 1-(disulfanyl)-2,5-dimethoxy-4-propan-2-ylbenzene |
| SMILES | COc1cc(C(C)C)c(OC)cc1SS |
| InChI | InChI=1S/C11H16O2S2/c1-7(2)8-5-10(13-4)11(15-14)6-9(8)12-3/h5-7,14H,1-4H3 |
| InChIKey | NKRMRDRAKRNKTC-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 18.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-(disulfanyl)-2,5-dimethoxy-4-propan-2-ylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(disulfanyl)-2,5-dimethoxy-4-propan-2-ylbenzene?
The IUPAC name of 1-(disulfanyl)-2,5-dimethoxy-4-propan-2-ylbenzene (CID 134182107) is 1-(disulfanyl)-2,5-dimethoxy-4-propan-2-ylbenzene.
What is the SMILES notation for 1-(disulfanyl)-2,5-dimethoxy-4-propan-2-ylbenzene?
The canonical SMILES for 1-(disulfanyl)-2,5-dimethoxy-4-propan-2-ylbenzene is COc1cc(C(C)C)c(OC)cc1SS.
What is the InChIKey of 1-(disulfanyl)-2,5-dimethoxy-4-propan-2-ylbenzene?
The InChIKey is NKRMRDRAKRNKTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H16O2S2/c1-7(2)8-5-10(13-4)11(15-14)6-9(8)12-3/h5-7,14H,1-4H3.
What are the key properties of 1-(disulfanyl)-2,5-dimethoxy-4-propan-2-ylbenzene?
1-(disulfanyl)-2,5-dimethoxy-4-propan-2-ylbenzene has a molecular weight of 244.38 g/mol, XLogP of 3.76, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(disulfanyl)-2,5-dimethoxy-4-propan-2-ylbenzene is sourced from PubChem (CID 134182107), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).