C12H15NO2 — CID 117293477
2,4-dimethoxy-5-propan-2-ylbenzonitrile (PubChem CID 117293477) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 2,4-dimethoxy-5-propan-2-ylbenzonitrile.
| Compound Name | 2,4-dimethoxy-5-propan-2-ylbenzonitrile |
|---|---|
| PubChem CID | 117293477 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 2,4-dimethoxy-5-propan-2-ylbenzonitrile |
| SMILES | COc1cc(OC)c(C(C)C)cc1C#N |
| InChI | InChI=1S/C12H15NO2/c1-8(2)10-5-9(7-13)11(14-3)6-12(10)15-4/h5-6,8H,1-4H3 |
| InChIKey | HRXOCORSVOGWCG-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 42.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |