C14H19BO4 — CID 167587834
ethyl 2-[(1-methyl-3H-2,1-benzoxaborol-6-yl)oxy]butanoate (PubChem CID 167587834) has the molecular formula C14H19BO4 and a molecular weight of 262.11 g/mol. Its IUPAC name is ethyl 2-[(1-methyl-3H-2,1-benzoxaborol-6-yl)oxy]butanoate.
| Compound Name | ethyl 2-[(1-methyl-3H-2,1-benzoxaborol-6-yl)oxy]butanoate |
|---|---|
| PubChem CID | 167587834 |
| Molecular Formula | C14H19BO4 |
| Molecular Weight | 262.11 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | ethyl 2-[(1-methyl-3H-2,1-benzoxaborol-6-yl)oxy]butanoate |
| SMILES | CCOC(=O)C(CC)Oc1ccc2c(c1)B(C)OC2 |
| InChI | InChI=1S/C14H19BO4/c1-4-13(14(16)17-5-2)19-11-7-6-10-9-18-15(3)12(10)8-11/h6-8,13H,4-5,9H2,1-3H3 |
| InChIKey | STBHVDDWUWGOGB-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.11 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|