C14H12BFO2 — CID 59855526
[3-(5-fluoro-3H-2,1-benzoxaborol-1-yl)phenyl]methanol (PubChem CID 59855526) has the molecular formula C14H12BFO2 and a molecular weight of 242.06 g/mol. Its IUPAC name is [3-(5-fluoro-3H-2,1-benzoxaborol-1-yl)phenyl]methanol.
| Compound Name | [3-(5-fluoro-3H-2,1-benzoxaborol-1-yl)phenyl]methanol |
|---|---|
| PubChem CID | 59855526 |
| Molecular Formula | C14H12BFO2 |
| Molecular Weight | 242.06 g/mol |
| Exact Mass | 242.09 |
| IUPAC Name | [3-(5-fluoro-3H-2,1-benzoxaborol-1-yl)phenyl]methanol |
| SMILES | OCc1cccc(B2OCc3cc(F)ccc32)c1 |
| InChI | InChI=1S/C14H12BFO2/c16-13-4-5-14-11(7-13)9-18-15(14)12-3-1-2-10(6-12)8-17/h1-7,17H,8-9H2 |
| InChIKey | NAVMPNYRWKJAGG-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.06 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|