C14H13BFNO — CID 11424997
[4-(5-fluoro-3H-2,1-benzoxaborol-1-yl)phenyl]methanamine (PubChem CID 11424997) has the molecular formula C14H13BFNO and a molecular weight of 241.07 g/mol. Its IUPAC name is [4-(5-fluoro-3H-2,1-benzoxaborol-1-yl)phenyl]methanamine.
| Compound Name | [4-(5-fluoro-3H-2,1-benzoxaborol-1-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 11424997 |
| Molecular Formula | C14H13BFNO |
| Molecular Weight | 241.07 g/mol |
| Exact Mass | 241.11 |
| IUPAC Name | [4-(5-fluoro-3H-2,1-benzoxaborol-1-yl)phenyl]methanamine |
| SMILES | NCc1ccc(B2OCc3cc(F)ccc32)cc1 |
| InChI | InChI=1S/C14H13BFNO/c16-13-5-6-14-11(7-13)9-18-15(14)12-3-1-10(8-17)2-4-12/h1-7H,8-9,17H2 |
| InChIKey | MKAAGQFSWKLCNL-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.07 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|