C15H14BClO2 — CID 140829353
5-chloro-6-(3,4-dimethylphenyl)-1-hydroxy-3H-2,1-benzoxaborole (PubChem CID 140829353) has the molecular formula C15H14BClO2 and a molecular weight of 272.54 g/mol. Its IUPAC name is 5-chloro-6-(3,4-dimethylphenyl)-1-hydroxy-3H-2,1-benzoxaborole.
| Compound Name | 5-chloro-6-(3,4-dimethylphenyl)-1-hydroxy-3H-2,1-benzoxaborole |
|---|---|
| PubChem CID | 140829353 |
| Molecular Formula | C15H14BClO2 |
| Molecular Weight | 272.54 g/mol |
| Exact Mass | 272.08 |
| IUPAC Name | 5-chloro-6-(3,4-dimethylphenyl)-1-hydroxy-3H-2,1-benzoxaborole |
| SMILES | Cc1ccc(-c2cc3c(cc2Cl)COB3O)cc1C |
| InChI | InChI=1S/C15H14BClO2/c1-9-3-4-11(5-10(9)2)13-7-14-12(6-15(13)17)8-19-16(14)18/h3-7,18H,8H2,1-2H3 |
| InChIKey | BUUBTALMFDQHJB-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.54 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|