C16H16BClN2O3 — CID 140829386
4-[5-(5-chloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)-2-pyridinyl]morpholine (PubChem CID 140829386) has the molecular formula C16H16BClN2O3 and a molecular weight of 330.58 g/mol. Its IUPAC name is 4-[5-(5-chloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)-2-pyridinyl]morpholine.
| Compound Name | 4-[5-(5-chloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)-2-pyridinyl]morpholine |
|---|---|
| PubChem CID | 140829386 |
| Molecular Formula | C16H16BClN2O3 |
| Molecular Weight | 330.58 g/mol |
| Exact Mass | 330.09 |
| IUPAC Name | 4-[5-(5-chloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)-2-pyridinyl]morpholine |
| SMILES | OB1OCc2cc(Cl)c(-c3ccc(N4CCOCC4)nc3)cc21 |
| InChI | InChI=1S/C16H16BClN2O3/c18-15-7-12-10-23-17(21)14(12)8-13(15)11-1-2-16(19-9-11)20-3-5-22-6-4-20/h1-2,7-9,21H,3-6,10H2 |
| InChIKey | HRKSCJZUCUQRLV-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 54.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.58 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|