C19H23ClN4O2 — CID 172626752
(3S)-1-[2-chloro-5-(6-morpholin-4-yl-3-pyridinyl)-4-pyridinyl]piperidin-3-ol (PubChem CID 172626752) has the molecular formula C19H23ClN4O2 and a molecular weight of 374.87 g/mol. Its IUPAC name is (3S)-1-[2-chloro-5-(6-morpholin-4-yl-3-pyridinyl)-4-pyridinyl]piperidin-3-ol.
| Compound Name | (3S)-1-[2-chloro-5-(6-morpholin-4-yl-3-pyridinyl)-4-pyridinyl]piperidin-3-ol |
|---|---|
| PubChem CID | 172626752 |
| Molecular Formula | C19H23ClN4O2 |
| Molecular Weight | 374.87 g/mol |
| Exact Mass | 374.15 |
| IUPAC Name | (3S)-1-[2-chloro-5-(6-morpholin-4-yl-3-pyridinyl)-4-pyridinyl]piperidin-3-ol |
| SMILES | O[C@H]1CCCN(c2cc(Cl)ncc2-c2ccc(N3CCOCC3)nc2)C1 |
| InChI | InChI=1S/C19H23ClN4O2/c20-18-10-17(24-5-1-2-15(25)13-24)16(12-21-18)14-3-4-19(22-11-14)23-6-8-26-9-7-23/h3-4,10-12,15,25H,1-2,5-9,13H2/t15-/m0/s1 |
| InChIKey | RYTLWTSNWYHGGE-HNNXBMFYSA-N |
| XLogP | 2.59 |
| TPSA | 61.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.87 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|