C11H7BCl2O2S — CID 140829460
5-chloro-6-(2-chlorothiophen-3-yl)-1-hydroxy-3H-2,1-benzoxaborole (PubChem CID 140829460) has the molecular formula C11H7BCl2O2S and a molecular weight of 284.96 g/mol. Its IUPAC name is 5-chloro-6-(2-chlorothiophen-3-yl)-1-hydroxy-3H-2,1-benzoxaborole.
| Compound Name | 5-chloro-6-(2-chlorothiophen-3-yl)-1-hydroxy-3H-2,1-benzoxaborole |
|---|---|
| PubChem CID | 140829460 |
| Molecular Formula | C11H7BCl2O2S |
| Molecular Weight | 284.96 g/mol |
| Exact Mass | 283.96 |
| IUPAC Name | 5-chloro-6-(2-chlorothiophen-3-yl)-1-hydroxy-3H-2,1-benzoxaborole |
| SMILES | OB1OCc2cc(Cl)c(-c3ccsc3Cl)cc21 |
| InChI | InChI=1S/C11H7BCl2O2S/c13-10-3-6-5-16-12(15)9(6)4-8(10)7-1-2-17-11(7)14/h1-4,15H,5H2 |
| InChIKey | CJXQVCLOVRHGFN-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.96 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|