C11H8BClO2S — CID 140829415
5-chloro-1-hydroxy-6-thiophen-2-yl-3H-2,1-benzoxaborole (PubChem CID 140829415) has the molecular formula C11H8BClO2S and a molecular weight of 250.52 g/mol. Its IUPAC name is 5-chloro-1-hydroxy-6-thiophen-2-yl-3H-2,1-benzoxaborole.
| Compound Name | 5-chloro-1-hydroxy-6-thiophen-2-yl-3H-2,1-benzoxaborole |
|---|---|
| PubChem CID | 140829415 |
| Molecular Formula | C11H8BClO2S |
| Molecular Weight | 250.52 g/mol |
| Exact Mass | 250.00 |
| IUPAC Name | 5-chloro-1-hydroxy-6-thiophen-2-yl-3H-2,1-benzoxaborole |
| SMILES | OB1OCc2cc(Cl)c(-c3cccs3)cc21 |
| InChI | InChI=1S/C11H8BClO2S/c13-10-4-7-6-15-12(14)9(7)5-8(10)11-2-1-3-16-11/h1-5,14H,6H2 |
| InChIKey | ZFGHEBWKXGNCHD-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.52 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|