C11H9BO2S — CID 174580764
1-hydroxy-6-thiophen-2-yl-3H-2,1-benzoxaborole (PubChem CID 174580764) has the molecular formula C11H9BO2S and a molecular weight of 216.07 g/mol. Its IUPAC name is 1-hydroxy-6-thiophen-2-yl-3H-2,1-benzoxaborole.
| Compound Name | 1-hydroxy-6-thiophen-2-yl-3H-2,1-benzoxaborole |
|---|---|
| PubChem CID | 174580764 |
| Molecular Formula | C11H9BO2S |
| Molecular Weight | 216.07 g/mol |
| Exact Mass | 216.04 |
| IUPAC Name | 1-hydroxy-6-thiophen-2-yl-3H-2,1-benzoxaborole |
| SMILES | OB1OCc2ccc(-c3cccs3)cc21 |
| InChI | InChI=1S/C11H9BO2S/c13-12-10-6-8(11-2-1-5-15-11)3-4-9(10)7-14-12/h1-6,13H,7H2 |
| InChIKey | PXHKRLTYNDCHEK-UHFFFAOYSA-N |
| XLogP | 1.63 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.07 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|