C36H36B2S — CID 102100974
2-[7,8-dimethyl-5,10-bis(2,4,6-trimethylphenyl)boranthren-2-yl]thiophene (PubChem CID 102100974) has the molecular formula C36H36B2S and a molecular weight of 522.38 g/mol. Its IUPAC name is 2-[7,8-dimethyl-5,10-bis(2,4,6-trimethylphenyl)boranthren-2-yl]thiophene.
| Compound Name | 2-[7,8-dimethyl-5,10-bis(2,4,6-trimethylphenyl)boranthren-2-yl]thiophene |
|---|---|
| PubChem CID | 102100974 |
| Molecular Formula | C36H36B2S |
| Molecular Weight | 522.38 g/mol |
| Exact Mass | 522.27 |
| IUPAC Name | 2-[7,8-dimethyl-5,10-bis(2,4,6-trimethylphenyl)boranthren-2-yl]thiophene |
| SMILES | Cc1cc(C)c(B2c3ccc(-c4cccs4)cc3B(c3c(C)cc(C)cc3C)c3cc(C)c(C)cc32)c(C)c1 |
| InChI | InChI=1S/C36H36B2S/c1-21-14-25(5)35(26(6)15-21)37-30-12-11-29(34-10-9-13-39-34)20-33(30)38(32-19-24(4)23(3)18-31(32)37)36-27(7)16-22(2)17-28(36)8/h9-20H,1-8H3 |
| InChIKey | PTOHKUNQLVXXHU-UHFFFAOYSA-N |
| XLogP | 5.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.38 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|