C13H8BClF3NO2 — CID 140829444
3-(5-chloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)-4-(trifluoromethyl)pyridine (PubChem CID 140829444) has the molecular formula C13H8BClF3NO2 and a molecular weight of 313.47 g/mol. Its IUPAC name is 3-(5-chloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)-4-(trifluoromethyl)pyridine.
| Compound Name | 3-(5-chloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)-4-(trifluoromethyl)pyridine |
|---|---|
| PubChem CID | 140829444 |
| Molecular Formula | C13H8BClF3NO2 |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.03 |
| IUPAC Name | 3-(5-chloro-1-hydroxy-3H-2,1-benzoxaborol-6-yl)-4-(trifluoromethyl)pyridine |
| SMILES | OB1OCc2cc(Cl)c(-c3cnccc3C(F)(F)F)cc21 |
| InChI | InChI=1S/C13H8BClF3NO2/c15-12-3-7-6-21-14(20)11(7)4-8(12)9-5-19-2-1-10(9)13(16,17)18/h1-5,20H,6H2 |
| InChIKey | WMDUSDBMCHJDNB-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|