C15H12BF3N2O3 — CID 50939696
1-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-3-[2-(trifluoromethyl)phenyl]urea (PubChem CID 50939696) has the molecular formula C15H12BF3N2O3 and a molecular weight of 336.08 g/mol. Its IUPAC name is 1-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-3-[2-(trifluoromethyl)phenyl]urea.
| Compound Name | 1-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-3-[2-(trifluoromethyl)phenyl]urea |
|---|---|
| PubChem CID | 50939696 |
| Molecular Formula | C15H12BF3N2O3 |
| Molecular Weight | 336.08 g/mol |
| Exact Mass | 336.09 |
| IUPAC Name | 1-(1-hydroxy-3H-2,1-benzoxaborol-6-yl)-3-[2-(trifluoromethyl)phenyl]urea |
| SMILES | O=C(Nc1ccc2c(c1)B(O)OC2)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C15H12BF3N2O3/c17-15(18,19)11-3-1-2-4-13(11)21-14(22)20-10-6-5-9-8-24-16(23)12(9)7-10/h1-7,23H,8H2,(H2,20,21,22) |
| InChIKey | LUHYSMRYEBOZKA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.08 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|