C12H15BClNO2 — CID 142602015
5-chloro-N-(cyclobutylmethyl)-1-hydroxy-3H-2,1-benzoxaborol-6-amine (PubChem CID 142602015) has the molecular formula C12H15BClNO2 and a molecular weight of 251.52 g/mol. Its IUPAC name is 5-chloro-N-(cyclobutylmethyl)-1-hydroxy-3H-2,1-benzoxaborol-6-amine.
| Compound Name | 5-chloro-N-(cyclobutylmethyl)-1-hydroxy-3H-2,1-benzoxaborol-6-amine |
|---|---|
| PubChem CID | 142602015 |
| Molecular Formula | C12H15BClNO2 |
| Molecular Weight | 251.52 g/mol |
| Exact Mass | 251.09 |
| IUPAC Name | 5-chloro-N-(cyclobutylmethyl)-1-hydroxy-3H-2,1-benzoxaborol-6-amine |
| SMILES | OB1OCc2cc(Cl)c(NCC3CCC3)cc21 |
| InChI | InChI=1S/C12H15BClNO2/c14-11-4-9-7-17-13(16)10(9)5-12(11)15-6-8-2-1-3-8/h4-5,8,15-16H,1-3,6-7H2 |
| InChIKey | BEPICKOTLYLVNQ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.52 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|